C13H17N3O — CID 84626661
7,8-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one (PubChem CID 84626661) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 7,8-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one.
| Compound Name | 7,8-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one |
|---|---|
| PubChem CID | 84626661 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 7,8-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one |
| SMILES | Cc1ccc2c(c1C)NC(=O)C1CNCCN21 |
| InChI | InChI=1S/C13H17N3O/c1-8-3-4-10-12(9(8)2)15-13(17)11-7-14-5-6-16(10)11/h3-4,11,14H,5-7H2,1-2H3,(H,15,17) |
| InChIKey | MRIJIBLAUHJVPQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |