C29H34N6O3S — CID 177059967
N-[4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]-2-[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]acetamide (PubChem CID 177059967) has the molecular formula C29H34N6O3S and a molecular weight of 546.70 g/mol. Its IUPAC name is N-[4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]-2-[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]acetamide.
| Compound Name | N-[4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]-2-[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 177059967 |
| Molecular Formula | C29H34N6O3S |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | N-[4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]-2-[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]acetamide |
| SMILES | O=C1CCC(n2cc(-c3csc(CC(=O)Nc4ccc(CN5CCC[C@@H]6CCCC[C@@H]65)cc4)c3)nn2)C(=O)N1 |
| InChI | InChI=1S/C29H34N6O3S/c36-27-12-11-26(29(38)31-27)35-17-24(32-33-35)21-14-23(39-18-21)15-28(37)30-22-9-7-19(8-10-22)16-34-13-3-5-20-4-1-2-6-25(20)34/h7-10,14,17-18,20,25-26H,1-6,11-13,15-16H2,(H,30,37)(H,31,36,38)/t20-,25-,26?/m0/s1 |
| InChIKey | PABXIZMZRZPLCV-AEXVEUJSSA-N |
| XLogP | 4.32 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|