C22H28N4O4 — CID 150341091
5-[[(1R,2S)-2-(dimethylamino)cyclohexyl]-methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 150341091) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-(dimethylamino)cyclohexyl]-methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(1R,2S)-2-(dimethylamino)cyclohexyl]-methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 150341091 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 5-[[(1R,2S)-2-(dimethylamino)cyclohexyl]-methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(C)[C@H]1CCCC[C@H]1N(C)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28N4O4/c1-24(2)16-6-4-5-7-17(16)25(3)13-8-9-14-15(12-13)22(30)26(21(14)29)18-10-11-19(27)23-20(18)28/h8-9,12,16-18H,4-7,10-11H2,1-3H3,(H,23,27,28)/t16-,17+,18?/m0/s1 |
| InChIKey | GRSMUWASIAPNRH-MYFVLZFPSA-N |
| XLogP | 1.40 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|