C20H25ClN4O4 — CID 171705598
2-(2,6-dioxopiperidin-3-yl)-5-[methyl(piperidin-4-ylmethyl)amino]isoindole-1,3-dione;hydrochloride (PubChem CID 171705598) has the molecular formula C20H25ClN4O4 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[methyl(piperidin-4-ylmethyl)amino]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[methyl(piperidin-4-ylmethyl)amino]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171705598 |
| Molecular Formula | C20H25ClN4O4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[methyl(piperidin-4-ylmethyl)amino]isoindole-1,3-dione;hydrochloride |
| SMILES | CN(CC1CCNCC1)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O.Cl |
| InChI | InChI=1S/C20H24N4O4.ClH/c1-23(11-12-6-8-21-9-7-12)13-2-3-14-15(10-13)20(28)24(19(14)27)16-4-5-17(25)22-18(16)26;/h2-3,10,12,16,21H,4-9,11H2,1H3,(H,22,25,26);1H |
| InChIKey | AXRUXHHKEQKLPR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|