C25H37N5O3 — CID 175638647
tert-butyl N-[6-[4-[1-(2-oxoazepan-3-yl)triazol-4-yl]phenyl]hexyl]carbamate (PubChem CID 175638647) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[1-(2-oxoazepan-3-yl)triazol-4-yl]phenyl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[1-(2-oxoazepan-3-yl)triazol-4-yl]phenyl]hexyl]carbamate |
|---|---|
| PubChem CID | 175638647 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | tert-butyl N-[6-[4-[1-(2-oxoazepan-3-yl)triazol-4-yl]phenyl]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCc1ccc(-c2cn(C3CCCCNC3=O)nn2)cc1 |
| InChI | InChI=1S/C25H37N5O3/c1-25(2,3)33-24(32)27-17-8-5-4-6-10-19-12-14-20(15-13-19)21-18-30(29-28-21)22-11-7-9-16-26-23(22)31/h12-15,18,22H,4-11,16-17H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | CICJOEHKYIKJQR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|