C30H39N5O3 — CID 70252709
tert-butyl N-[3-[4-[2-[3-(hydroxymethyl)-4-piperidin-1-ylanilino]pyrimidin-4-yl]phenyl]propyl]carbamate (PubChem CID 70252709) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[3-(hydroxymethyl)-4-piperidin-1-ylanilino]pyrimidin-4-yl]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[3-(hydroxymethyl)-4-piperidin-1-ylanilino]pyrimidin-4-yl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 70252709 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[3-(hydroxymethyl)-4-piperidin-1-ylanilino]pyrimidin-4-yl]phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(-c2ccnc(Nc3ccc(N4CCCCC4)c(CO)c3)n2)cc1 |
| InChI | InChI=1S/C30H39N5O3/c1-30(2,3)38-29(37)32-16-7-8-22-9-11-23(12-10-22)26-15-17-31-28(34-26)33-25-13-14-27(24(20-25)21-36)35-18-5-4-6-19-35/h9-15,17,20,36H,4-8,16,18-19,21H2,1-3H3,(H,32,37)(H,31,33,34) |
| InChIKey | MAJHJCUSZLIJNG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|