C27H33N5O4 — CID 58102630
tert-butyl N-[[5-[[4-[3-(hydroxymethyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]carbamate (PubChem CID 58102630) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is tert-butyl N-[[5-[[4-[3-(hydroxymethyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[[4-[3-(hydroxymethyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 58102630 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | tert-butyl N-[[5-[[4-[3-(hydroxymethyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(Nc2nccc(-c3cccc(CO)c3)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H33N5O4/c1-27(2,3)36-26(34)29-17-21-16-22(7-8-24(21)32-11-13-35-14-12-32)30-25-28-10-9-23(31-25)20-6-4-5-19(15-20)18-33/h4-10,15-16,33H,11-14,17-18H2,1-3H3,(H,29,34)(H,28,30,31) |
| InChIKey | MLUQLNLKPZTMRR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|