C32H42N6O4 — CID 163445782
tert-butyl N-[3-[methyl-[[4-[2-[3-morpholin-4-yl-5-(2-oxoethyl)anilino]pyrimidin-4-yl]phenyl]methyl]amino]propyl]carbamate (PubChem CID 163445782) has the molecular formula C32H42N6O4 and a molecular weight of 574.73 g/mol. Its IUPAC name is tert-butyl N-[3-[methyl-[[4-[2-[3-morpholin-4-yl-5-(2-oxoethyl)anilino]pyrimidin-4-yl]phenyl]methyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[methyl-[[4-[2-[3-morpholin-4-yl-5-(2-oxoethyl)anilino]pyrimidin-4-yl]phenyl]methyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 163445782 |
| Molecular Formula | C32H42N6O4 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | tert-butyl N-[3-[methyl-[[4-[2-[3-morpholin-4-yl-5-(2-oxoethyl)anilino]pyrimidin-4-yl]phenyl]methyl]amino]propyl]carbamate |
| SMILES | CN(CCCNC(=O)OC(C)(C)C)Cc1ccc(-c2ccnc(Nc3cc(CC=O)cc(N4CCOCC4)c3)n2)cc1 |
| InChI | InChI=1S/C32H42N6O4/c1-32(2,3)42-31(40)34-12-5-14-37(4)23-24-6-8-26(9-7-24)29-10-13-33-30(36-29)35-27-20-25(11-17-39)21-28(22-27)38-15-18-41-19-16-38/h6-10,13,17,20-22H,5,11-12,14-16,18-19,23H2,1-4H3,(H,34,40)(H,33,35,36) |
| InChIKey | BCJPBERQFGSTRD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|