C22H28N6O3 — CID 131723670
tert-butyl N-[2-[[4-(4-cyanophenyl)-6-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]carbamate (PubChem CID 131723670) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(4-cyanophenyl)-6-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(4-cyanophenyl)-6-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 131723670 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | tert-butyl N-[2-[[4-(4-cyanophenyl)-6-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(-c2ccc(C#N)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H28N6O3/c1-22(2,3)31-21(29)25-9-8-24-20-26-18(17-6-4-16(15-23)5-7-17)14-19(27-20)28-10-12-30-13-11-28/h4-7,14H,8-13H2,1-3H3,(H,25,29)(H,24,26,27) |
| InChIKey | LURZRIZIXBHXOX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|