C31H39N5O6 — CID 166871649
4-[2-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxymethyl]-4-morpholin-4-ylanilino]pyrimidin-4-yl]benzoic acid (PubChem CID 166871649) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is 4-[2-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxymethyl]-4-morpholin-4-ylanilino]pyrimidin-4-yl]benzoic acid.
| Compound Name | 4-[2-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxymethyl]-4-morpholin-4-ylanilino]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 166871649 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 4-[2-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxymethyl]-4-morpholin-4-ylanilino]pyrimidin-4-yl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCOCc1cc(Nc2nccc(-c3ccc(C(=O)O)cc3)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C31H39N5O6/c1-31(2,3)42-30(39)33-13-4-5-17-41-21-24-20-25(10-11-27(24)36-15-18-40-19-16-36)34-29-32-14-12-26(35-29)22-6-8-23(9-7-22)28(37)38/h6-12,14,20H,4-5,13,15-19,21H2,1-3H3,(H,33,39)(H,37,38)(H,32,34,35) |
| InChIKey | UUURDVJEIPZPQM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|