C25H32N6O3 — CID 118427957
tert-butyl N-[3-[[5-[2-[3-(hydroxymethyl)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-N-methylcarbamate (PubChem CID 118427957) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-[2-[3-(hydroxymethyl)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[5-[2-[3-(hydroxymethyl)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118427957 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | tert-butyl N-[3-[[5-[2-[3-(hydroxymethyl)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-N-methylcarbamate |
| SMILES | CN(CCCNc1ccc(-c2ccnc(Nc3cccc(CO)c3)n2)cn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N6O3/c1-25(2,3)34-24(33)31(4)14-6-12-26-22-10-9-19(16-28-22)21-11-13-27-23(30-21)29-20-8-5-7-18(15-20)17-32/h5,7-11,13,15-16,32H,6,12,14,17H2,1-4H3,(H,26,28)(H,27,29,30) |
| InChIKey | WIJLLNZQZMOJID-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|