C20H25N7O — CID 118428057
[5-[[4-[6-[methyl-[3-(methylamino)propyl]amino]-3-pyridinyl]pyrimidin-2-yl]amino]-3-pyridinyl]methanol (PubChem CID 118428057) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is [5-[[4-[6-[methyl-[3-(methylamino)propyl]amino]-3-pyridinyl]pyrimidin-2-yl]amino]-3-pyridinyl]methanol.
| Compound Name | [5-[[4-[6-[methyl-[3-(methylamino)propyl]amino]-3-pyridinyl]pyrimidin-2-yl]amino]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118428057 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [5-[[4-[6-[methyl-[3-(methylamino)propyl]amino]-3-pyridinyl]pyrimidin-2-yl]amino]-3-pyridinyl]methanol |
| SMILES | CNCCCN(C)c1ccc(-c2ccnc(Nc3cncc(CO)c3)n2)cn1 |
| InChI | InChI=1S/C20H25N7O/c1-21-7-3-9-27(2)19-5-4-16(12-24-19)18-6-8-23-20(26-18)25-17-10-15(14-28)11-22-13-17/h4-6,8,10-13,21,28H,3,7,9,14H2,1-2H3,(H,23,25,26) |
| InChIKey | OPJUICAHGSAAQD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|