C24H27N7O2 — CID 10343482
2-[methyl-[3-[3-[[4-(2-pyridin-3-yl-1H-imidazol-5-yl)pyrimidin-2-yl]amino]phenoxy]propyl]amino]ethanol (PubChem CID 10343482) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-[methyl-[3-[3-[[4-(2-pyridin-3-yl-1H-imidazol-5-yl)pyrimidin-2-yl]amino]phenoxy]propyl]amino]ethanol.
| Compound Name | 2-[methyl-[3-[3-[[4-(2-pyridin-3-yl-1H-imidazol-5-yl)pyrimidin-2-yl]amino]phenoxy]propyl]amino]ethanol |
|---|---|
| PubChem CID | 10343482 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[methyl-[3-[3-[[4-(2-pyridin-3-yl-1H-imidazol-5-yl)pyrimidin-2-yl]amino]phenoxy]propyl]amino]ethanol |
| SMILES | CN(CCO)CCCOc1cccc(Nc2nccc(-c3cnc(-c4cccnc4)[nH]3)n2)c1 |
| InChI | InChI=1S/C24H27N7O2/c1-31(12-13-32)11-4-14-33-20-7-2-6-19(15-20)28-24-26-10-8-21(30-24)22-17-27-23(29-22)18-5-3-9-25-16-18/h2-3,5-10,15-17,32H,4,11-14H2,1H3,(H,27,29)(H,26,28,30) |
| InChIKey | FAXYNRZEMUHCRK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|