C26H30N8O2 — CID 59698640
4-[2-(5-methoxy-3-pyridinyl)-1H-imidazol-5-yl]-N-[3-(3-piperazin-1-ylpropoxy)phenyl]pyrimidin-2-amine (PubChem CID 59698640) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 4-[2-(5-methoxy-3-pyridinyl)-1H-imidazol-5-yl]-N-[3-(3-piperazin-1-ylpropoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[2-(5-methoxy-3-pyridinyl)-1H-imidazol-5-yl]-N-[3-(3-piperazin-1-ylpropoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59698640 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-[2-(5-methoxy-3-pyridinyl)-1H-imidazol-5-yl]-N-[3-(3-piperazin-1-ylpropoxy)phenyl]pyrimidin-2-amine |
| SMILES | COc1cncc(-c2ncc(-c3ccnc(Nc4cccc(OCCCN5CCNCC5)c4)n3)[nH]2)c1 |
| InChI | InChI=1S/C26H30N8O2/c1-35-22-14-19(16-28-17-22)25-30-18-24(32-25)23-6-7-29-26(33-23)31-20-4-2-5-21(15-20)36-13-3-10-34-11-8-27-9-12-34/h2,4-7,14-18,27H,3,8-13H2,1H3,(H,30,32)(H,29,31,33) |
| InChIKey | QXBKSFLRHMVIDY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|