C35H34N6OS2 — CID 23544443
2-methylsulfanyl-4-(3-phenylphenyl)-5-[2-[3-(3-piperazin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile (PubChem CID 23544443) has the molecular formula C35H34N6OS2 and a molecular weight of 618.83 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(3-phenylphenyl)-5-[2-[3-(3-piperazin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-(3-phenylphenyl)-5-[2-[3-(3-piperazin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 23544443 |
| Molecular Formula | C35H34N6OS2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 2-methylsulfanyl-4-(3-phenylphenyl)-5-[2-[3-(3-piperazin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
| SMILES | CSc1sc(-c2ccnc(Nc3cccc(OCCCN4CCNCC4)c3)n2)c(-c2cccc(-c3ccccc3)c2)c1C#N |
| InChI | InChI=1S/C35H34N6OS2/c1-43-34-30(24-36)32(27-11-5-10-26(22-27)25-8-3-2-4-9-25)33(44-34)31-14-15-38-35(40-31)39-28-12-6-13-29(23-28)42-21-7-18-41-19-16-37-17-20-41/h2-6,8-15,22-23,37H,7,16-21H2,1H3,(H,38,39,40) |
| InChIKey | VSVATIYQYNCPOQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|