C24H18N4OS3 — CID 2821178
S-[4-(4-cyano-5-methylsulfanyl-3-phenylthiophen-2-yl)pyrimidin-2-yl] 2-anilinoethanethioate (PubChem CID 2821178) has the molecular formula C24H18N4OS3 and a molecular weight of 474.64 g/mol. Its IUPAC name is S-[4-(4-cyano-5-methylsulfanyl-3-phenylthiophen-2-yl)pyrimidin-2-yl] 2-anilinoethanethioate.
| Compound Name | S-[4-(4-cyano-5-methylsulfanyl-3-phenylthiophen-2-yl)pyrimidin-2-yl] 2-anilinoethanethioate |
|---|---|
| PubChem CID | 2821178 |
| Molecular Formula | C24H18N4OS3 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | S-[4-(4-cyano-5-methylsulfanyl-3-phenylthiophen-2-yl)pyrimidin-2-yl] 2-anilinoethanethioate |
| SMILES | CSc1sc(-c2ccnc(SC(=O)CNc3ccccc3)n2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C24H18N4OS3/c1-30-23-18(14-25)21(16-8-4-2-5-9-16)22(32-23)19-12-13-26-24(28-19)31-20(29)15-27-17-10-6-3-7-11-17/h2-13,27H,15H2,1H3 |
| InChIKey | TVTDMXSANOOMAU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|