C29H35N5OS2 — CID 10302143
4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-pyrrolidin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile (PubChem CID 10302143) has the molecular formula C29H35N5OS2 and a molecular weight of 533.77 g/mol. Its IUPAC name is 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-pyrrolidin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile.
| Compound Name | 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-pyrrolidin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 10302143 |
| Molecular Formula | C29H35N5OS2 |
| Molecular Weight | 533.77 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-pyrrolidin-1-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
| SMILES | CSc1sc(-c2ccnc(Nc3cccc(OCCCN4CCCC4)c3)n2)c(C2CCCCC2)c1C#N |
| InChI | InChI=1S/C29H35N5OS2/c1-36-28-24(20-30)26(21-9-3-2-4-10-21)27(37-28)25-13-14-31-29(33-25)32-22-11-7-12-23(19-22)35-18-8-17-34-15-5-6-16-34/h7,11-14,19,21H,2-6,8-10,15-18H2,1H3,(H,31,32,33) |
| InChIKey | RGSCJXLMEIWGPN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.77 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|