C29H40N6O3 — CID 10208222
2-[4-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)pyrimidin-2-yl]amino]phenoxy]propyl]piperazin-1-yl]ethanol (PubChem CID 10208222) has the molecular formula C29H40N6O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is 2-[4-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)pyrimidin-2-yl]amino]phenoxy]propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)pyrimidin-2-yl]amino]phenoxy]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 10208222 |
| Molecular Formula | C29H40N6O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 2-[4-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)pyrimidin-2-yl]amino]phenoxy]propyl]piperazin-1-yl]ethanol |
| SMILES | Cc1onc(C2CCCCC2)c1-c1ccnc(Nc2cccc(OCCCN3CCN(CCO)CC3)c2)n1 |
| InChI | InChI=1S/C29H40N6O3/c1-22-27(28(33-38-22)23-7-3-2-4-8-23)26-11-12-30-29(32-26)31-24-9-5-10-25(21-24)37-20-6-13-34-14-16-35(17-15-34)18-19-36/h5,9-12,21,23,36H,2-4,6-8,13-20H2,1H3,(H,30,31,32) |
| InChIKey | MQILGPKRQZHOGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|