C25H30N4O5 — CID 10115878
2-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-(hydroxymethyl)pyrimidin-2-yl]amino]phenoxy]ethyl acetate (PubChem CID 10115878) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-(hydroxymethyl)pyrimidin-2-yl]amino]phenoxy]ethyl acetate.
| Compound Name | 2-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-(hydroxymethyl)pyrimidin-2-yl]amino]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 10115878 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-(hydroxymethyl)pyrimidin-2-yl]amino]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1cccc(Nc2ncc(CO)c(-c3c(C4CCCCC4)noc3C)n2)c1 |
| InChI | InChI=1S/C25H30N4O5/c1-16-22(24(29-34-16)18-7-4-3-5-8-18)23-19(15-30)14-26-25(28-23)27-20-9-6-10-21(13-20)33-12-11-32-17(2)31/h6,9-10,13-14,18,30H,3-5,7-8,11-12,15H2,1-2H3,(H,26,27,28) |
| InChIKey | KCBMNHHAUSUYOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|