C26H35N5O2 — CID 10161050
4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpyrimidin-2-amine (PubChem CID 10161050) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpyrimidin-2-amine.
| Compound Name | 4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 10161050 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpyrimidin-2-amine |
| SMILES | Cc1cnc(Nc2cccc(OCCCN(C)C)c2)nc1-c1c(C2CCCCC2)noc1C |
| InChI | InChI=1S/C26H35N5O2/c1-18-17-27-26(28-21-12-8-13-22(16-21)32-15-9-14-31(3)4)29-24(18)23-19(2)33-30-25(23)20-10-6-5-7-11-20/h8,12-13,16-17,20H,5-7,9-11,14-15H2,1-4H3,(H,27,28,29) |
| InChIKey | HIYDIMPDLVNJCM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|