C27H37N5O3 — CID 10116652
2-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-ethylpyrimidin-2-yl]amino]phenoxy]propylamino]ethanol (PubChem CID 10116652) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-ethylpyrimidin-2-yl]amino]phenoxy]propylamino]ethanol.
| Compound Name | 2-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-ethylpyrimidin-2-yl]amino]phenoxy]propylamino]ethanol |
|---|---|
| PubChem CID | 10116652 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 2-[3-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-ethylpyrimidin-2-yl]amino]phenoxy]propylamino]ethanol |
| SMILES | CCc1cnc(Nc2cccc(OCCCNCCO)c2)nc1-c1c(C2CCCCC2)noc1C |
| InChI | InChI=1S/C27H37N5O3/c1-3-20-18-29-27(30-22-11-7-12-23(17-22)34-16-8-13-28-14-15-33)31-25(20)24-19(2)35-32-26(24)21-9-5-4-6-10-21/h7,11-12,17-18,21,28,33H,3-6,8-10,13-16H2,1-2H3,(H,29,30,31) |
| InChIKey | IMOLOYNOBNUQFH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|