C21H30N4O3 — CID 90906418
N-cyclohexyl-4-[3-[2-(2-hydroxyethylamino)ethoxy]phenyl]-N-methylimidazole-1-carboxamide (PubChem CID 90906418) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-[2-(2-hydroxyethylamino)ethoxy]phenyl]-N-methylimidazole-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[3-[2-(2-hydroxyethylamino)ethoxy]phenyl]-N-methylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 90906418 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-cyclohexyl-4-[3-[2-(2-hydroxyethylamino)ethoxy]phenyl]-N-methylimidazole-1-carboxamide |
| SMILES | CN(C(=O)n1cnc(-c2cccc(OCCNCCO)c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C21H30N4O3/c1-24(18-7-3-2-4-8-18)21(27)25-15-20(23-16-25)17-6-5-9-19(14-17)28-13-11-22-10-12-26/h5-6,9,14-16,18,22,26H,2-4,7-8,10-13H2,1H3 |
| InChIKey | ZZXRIUWBZHEHEL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|