C16H21N4O2+ — CID 121366678
N-cyclohexyl-4-(1-hydroxypyridin-1-ium-4-yl)-N-methylimidazole-1-carboxamide (PubChem CID 121366678) has the molecular formula C16H21N4O2+ and a molecular weight of 301.37 g/mol. Its IUPAC name is N-cyclohexyl-4-(1-hydroxypyridin-1-ium-4-yl)-N-methylimidazole-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(1-hydroxypyridin-1-ium-4-yl)-N-methylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 121366678 |
| Molecular Formula | C16H21N4O2+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-cyclohexyl-4-(1-hydroxypyridin-1-ium-4-yl)-N-methylimidazole-1-carboxamide |
| SMILES | CN(C(=O)n1cnc(-c2cc[n+](O)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H21N4O2/c1-18(14-5-3-2-4-6-14)16(21)19-11-15(17-12-19)13-7-9-20(22)10-8-13/h7-12,14,22H,2-6H2,1H3/q+1 |
| InChIKey | FXRNQZSHRLRQOT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|