C27H34N6O4 — CID 10207552
2-(2-acetamidoethoxy)-N-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 10207552) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-(2-acetamidoethoxy)-N-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | 2-(2-acetamidoethoxy)-N-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 10207552 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-(2-acetamidoethoxy)-N-[3-[[4-(3-cyclohexyl-5-methyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)NCCOCC(=O)Nc1cccc(Nc2ncc(C)c(-c3c(C4CCCCC4)noc3C)n2)c1 |
| InChI | InChI=1S/C27H34N6O4/c1-17-15-29-27(32-25(17)24-18(2)37-33-26(24)20-8-5-4-6-9-20)31-22-11-7-10-21(14-22)30-23(35)16-36-13-12-28-19(3)34/h7,10-11,14-15,20H,4-6,8-9,12-13,16H2,1-3H3,(H,28,34)(H,30,35)(H,29,31,32) |
| InChIKey | LAXTZSMMFNGBES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|