C29H32N6OS — CID 59067838
4-cyclohexyl-2-methyl-5-[2-[3-[3-(4-methylimidazol-1-yl)propoxy]anilino]pyrimidin-4-yl]thiophene-3-carbonitrile (PubChem CID 59067838) has the molecular formula C29H32N6OS and a molecular weight of 512.68 g/mol. Its IUPAC name is 4-cyclohexyl-2-methyl-5-[2-[3-[3-(4-methylimidazol-1-yl)propoxy]anilino]pyrimidin-4-yl]thiophene-3-carbonitrile.
| Compound Name | 4-cyclohexyl-2-methyl-5-[2-[3-[3-(4-methylimidazol-1-yl)propoxy]anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 59067838 |
| Molecular Formula | C29H32N6OS |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 4-cyclohexyl-2-methyl-5-[2-[3-[3-(4-methylimidazol-1-yl)propoxy]anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
| SMILES | Cc1cn(CCCOc2cccc(Nc3nccc(-c4sc(C)c(C#N)c4C4CCCCC4)n3)c2)cn1 |
| InChI | InChI=1S/C29H32N6OS/c1-20-18-35(19-32-20)14-7-15-36-24-11-6-10-23(16-24)33-29-31-13-12-26(34-29)28-27(22-8-4-3-5-9-22)25(17-30)21(2)37-28/h6,10-13,16,18-19,22H,3-5,7-9,14-15H2,1-2H3,(H,31,33,34) |
| InChIKey | WOWUDWSZQPIYCL-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|