C26H26N8O2 — CID 73348812
4-[[2-methoxyethyl(methyl)amino]diazenyl]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (PubChem CID 73348812) has the molecular formula C26H26N8O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 4-[[2-methoxyethyl(methyl)amino]diazenyl]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-[[2-methoxyethyl(methyl)amino]diazenyl]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 73348812 |
| Molecular Formula | C26H26N8O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 4-[[2-methoxyethyl(methyl)amino]diazenyl]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| SMILES | COCCN(C)/N=N/c1ccc(C(=O)Nc2cccc(Nc3nccc(-c4cccnc4)n3)c2)cc1 |
| InChI | InChI=1S/C26H26N8O2/c1-34(15-16-36-2)33-32-21-10-8-19(9-11-21)25(35)29-22-6-3-7-23(17-22)30-26-28-14-12-24(31-26)20-5-4-13-27-18-20/h3-14,17-18H,15-16H2,1-2H3,(H,29,35)(H,28,30,31)/b33-32+ |
| InChIKey | BBDHTQFYMLKRHJ-ULIFNZDWSA-N |
| XLogP | 5.11 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|