C30H35N7O2S — CID 142362201
4-[[4-(dimethylamino)-3-sulfanylbutanoyl]amino]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide;ethane (PubChem CID 142362201) has the molecular formula C30H35N7O2S and a molecular weight of 557.72 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-3-sulfanylbutanoyl]amino]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide;ethane.
| Compound Name | 4-[[4-(dimethylamino)-3-sulfanylbutanoyl]amino]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide;ethane |
|---|---|
| PubChem CID | 142362201 |
| Molecular Formula | C30H35N7O2S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 4-[[4-(dimethylamino)-3-sulfanylbutanoyl]amino]-N-[3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide;ethane |
| SMILES | CC.CN(C)CC(S)CC(=O)Nc1ccc(C(=O)Nc2cccc(Nc3nccc(-c4cccnc4)n3)c2)cc1 |
| InChI | InChI=1S/C28H29N7O2S.C2H6/c1-35(2)18-24(38)16-26(36)31-21-10-8-19(9-11-21)27(37)32-22-6-3-7-23(15-22)33-28-30-14-12-25(34-28)20-5-4-13-29-17-20;1-2/h3-15,17,24,38H,16,18H2,1-2H3,(H,31,36)(H,32,37)(H,30,33,34);1-2H3 |
| InChIKey | OIQOMZUCXZYING-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|