C29H39N7 — CID 147892582
N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[6-(3-piperidin-1-ylpropyl)-3-pyridinyl]pyrimidin-2-amine (PubChem CID 147892582) has the molecular formula C29H39N7 and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[6-(3-piperidin-1-ylpropyl)-3-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[6-(3-piperidin-1-ylpropyl)-3-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 147892582 |
| Molecular Formula | C29H39N7 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[6-(3-piperidin-1-ylpropyl)-3-pyridinyl]pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2nccc(-c3ccc(CCCN4CCCCC4)nc3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C29H39N7/c1-23-21-26(10-11-28(23)36-19-17-34(2)18-20-36)32-29-30-13-12-27(33-29)24-8-9-25(31-22-24)7-6-16-35-14-4-3-5-15-35/h8-13,21-22H,3-7,14-20H2,1-2H3,(H,30,32,33) |
| InChIKey | ICORNKGPPPUNNU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|