C24H37N3O6S — CID 171843945
tert-butyl N-[6-[4-[(2,7-dioxoazepan-3-yl)-methylsulfamoyl]phenyl]hexyl]carbamate (PubChem CID 171843945) has the molecular formula C24H37N3O6S and a molecular weight of 495.64 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[(2,7-dioxoazepan-3-yl)-methylsulfamoyl]phenyl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[(2,7-dioxoazepan-3-yl)-methylsulfamoyl]phenyl]hexyl]carbamate |
|---|---|
| PubChem CID | 171843945 |
| Molecular Formula | C24H37N3O6S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | tert-butyl N-[6-[4-[(2,7-dioxoazepan-3-yl)-methylsulfamoyl]phenyl]hexyl]carbamate |
| SMILES | CN(C1CCCC(=O)NC1=O)S(=O)(=O)c1ccc(CCCCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H37N3O6S/c1-24(2,3)33-23(30)25-17-8-6-5-7-10-18-13-15-19(16-14-18)34(31,32)27(4)20-11-9-12-21(28)26-22(20)29/h13-16,20H,5-12,17H2,1-4H3,(H,25,30)(H,26,28,29) |
| InChIKey | ZAZROKMHGVRKPP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|