C14H13BrN2O2 — CID 167470600
3-(5-bromo-2-methylindol-1-yl)piperidine-2,6-dione (PubChem CID 167470600) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 3-(5-bromo-2-methylindol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-bromo-2-methylindol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167470600 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-(5-bromo-2-methylindol-1-yl)piperidine-2,6-dione |
| SMILES | Cc1cc2cc(Br)ccc2n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13BrN2O2/c1-8-6-9-7-10(15)2-3-11(9)17(8)12-4-5-13(18)16-14(12)19/h2-3,6-7,12H,4-5H2,1H3,(H,16,18,19) |
| InChIKey | WVWXQGHESOVVQC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|