C12H11IN4O2 — CID 66080420
3-(2-amino-5-iodobenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 66080420) has the molecular formula C12H11IN4O2 and a molecular weight of 370.15 g/mol. Its IUPAC name is 3-(2-amino-5-iodobenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-amino-5-iodobenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 66080420 |
| Molecular Formula | C12H11IN4O2 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 3-(2-amino-5-iodobenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | Nc1nc2cc(I)ccc2n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H11IN4O2/c13-6-1-2-8-7(5-6)15-12(14)17(8)9-3-4-10(18)16-11(9)19/h1-2,5,9H,3-4H2,(H2,14,15)(H,16,18,19) |
| InChIKey | YDNPVXQHLQDOKD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|