C15H14IN3S — CID 66080019
5-iodo-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazol-2-amine (PubChem CID 66080019) has the molecular formula C15H14IN3S and a molecular weight of 395.27 g/mol. Its IUPAC name is 5-iodo-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazol-2-amine.
| Compound Name | 5-iodo-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66080019 |
| Molecular Formula | C15H14IN3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 5-iodo-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)ccc2n1C1CCCc2sccc21 |
| InChI | InChI=1S/C15H14IN3S/c16-9-4-5-13-11(8-9)18-15(17)19(13)12-2-1-3-14-10(12)6-7-20-14/h4-8,12H,1-3H2,(H2,17,18) |
| InChIKey | YOWUQWIOGKTEAL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|