C12H14IN3O — CID 82729283
5-iodo-1-(2-methyloxolan-3-yl)benzimidazol-2-amine (PubChem CID 82729283) has the molecular formula C12H14IN3O and a molecular weight of 343.17 g/mol. Its IUPAC name is 5-iodo-1-(2-methyloxolan-3-yl)benzimidazol-2-amine.
| Compound Name | 5-iodo-1-(2-methyloxolan-3-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 82729283 |
| Molecular Formula | C12H14IN3O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-iodo-1-(2-methyloxolan-3-yl)benzimidazol-2-amine |
| SMILES | CC1OCCC1n1c(N)nc2cc(I)ccc21 |
| InChI | InChI=1S/C12H14IN3O/c1-7-10(4-5-17-7)16-11-3-2-8(13)6-9(11)15-12(16)14/h2-3,6-7,10H,4-5H2,1H3,(H2,14,15) |
| InChIKey | MBKSBQMNWDBQPG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|