C17H24IN3 — CID 103967512
5-iodo-1-(3,3,5,5-tetramethylcyclohexyl)benzimidazol-2-amine (PubChem CID 103967512) has the molecular formula C17H24IN3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 5-iodo-1-(3,3,5,5-tetramethylcyclohexyl)benzimidazol-2-amine.
| Compound Name | 5-iodo-1-(3,3,5,5-tetramethylcyclohexyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 103967512 |
| Molecular Formula | C17H24IN3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-iodo-1-(3,3,5,5-tetramethylcyclohexyl)benzimidazol-2-amine |
| SMILES | CC1(C)CC(n2c(N)nc3cc(I)ccc32)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24IN3/c1-16(2)8-12(9-17(3,4)10-16)21-14-6-5-11(18)7-13(14)20-15(21)19/h5-7,12H,8-10H2,1-4H3,(H2,19,20) |
| InChIKey | VGKNOMZEQQFZQG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|