C15H14IN3 — CID 66080790
1-(3,5-dimethylphenyl)-5-iodobenzimidazol-2-amine (PubChem CID 66080790) has the molecular formula C15H14IN3 and a molecular weight of 363.20 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66080790 |
| Molecular Formula | C15H14IN3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-5-iodobenzimidazol-2-amine |
| SMILES | Cc1cc(C)cc(-n2c(N)nc3cc(I)ccc32)c1 |
| InChI | InChI=1S/C15H14IN3/c1-9-5-10(2)7-12(6-9)19-14-4-3-11(16)8-13(14)18-15(19)17/h3-8H,1-2H3,(H2,17,18) |
| InChIKey | AUUKCXDQSRZBMD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|