C14H10F2IN3 — CID 103586598
1-(2,5-difluoro-4-methylphenyl)-5-iodobenzimidazol-2-amine (PubChem CID 103586598) has the molecular formula C14H10F2IN3 and a molecular weight of 385.16 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methylphenyl)-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(2,5-difluoro-4-methylphenyl)-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 103586598 |
| Molecular Formula | C14H10F2IN3 |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 1-(2,5-difluoro-4-methylphenyl)-5-iodobenzimidazol-2-amine |
| SMILES | Cc1cc(F)c(-n2c(N)nc3cc(I)ccc32)cc1F |
| InChI | InChI=1S/C14H10F2IN3/c1-7-4-10(16)13(6-9(7)15)20-12-3-2-8(17)5-11(12)19-14(20)18/h2-6H,1H3,(H2,18,19) |
| InChIKey | IXGVXIFKTUCNOM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|