About 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine
5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine (PubChem CID 66082790) has the molecular formula C13H7F3IN3
and a molecular weight of 389.12 g/mol. Its IUPAC name is 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine |
| PubChem CID | 66082790 |
| Molecular Formula | C13H7F3IN3 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)ccc2n1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H7F3IN3/c14-7-4-9(16)12(5-8(7)15)20-11-2-1-6(17)3-10(11)19-13(20)18/h1-5H,(H2,18,19) |
| InChIKey | LMJMLSHZGZGDHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine?
The IUPAC name of 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine (CID 66082790) is 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine.
What is the SMILES notation for 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine?
The canonical SMILES for 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine is Nc1nc2cc(I)ccc2n1-c1cc(F)c(F)cc1F.
What is the InChIKey of 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine?
The InChIKey is LMJMLSHZGZGDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3IN3/c14-7-4-9(16)12(5-8(7)15)20-11-2-1-6(17)3-10(11)19-13(20)18/h1-5H,(H2,18,19).
What are the key properties of 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine?
5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine has a molecular weight of 389.12 g/mol, XLogP of 3.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine is sourced from PubChem (CID 66082790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).