C13H7F3IN3 — CID 66082790
5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine (PubChem CID 66082790) has the molecular formula C13H7F3IN3 and a molecular weight of 389.12 g/mol. Its IUPAC name is 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine.
| Compound Name | 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66082790 |
| Molecular Formula | C13H7F3IN3 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 5-iodo-1-(2,4,5-trifluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)ccc2n1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H7F3IN3/c14-7-4-9(16)12(5-8(7)15)20-11-2-1-6(17)3-10(11)19-13(20)18/h1-5H,(H2,18,19) |
| InChIKey | LMJMLSHZGZGDHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|