C15H13ClFN3 — CID 66076552
5-chloro-1-(3,5-dimethylphenyl)-6-fluorobenzimidazol-2-amine (PubChem CID 66076552) has the molecular formula C15H13ClFN3 and a molecular weight of 289.74 g/mol. Its IUPAC name is 5-chloro-1-(3,5-dimethylphenyl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-chloro-1-(3,5-dimethylphenyl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66076552 |
| Molecular Formula | C15H13ClFN3 |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 5-chloro-1-(3,5-dimethylphenyl)-6-fluorobenzimidazol-2-amine |
| SMILES | Cc1cc(C)cc(-n2c(N)nc3cc(Cl)c(F)cc32)c1 |
| InChI | InChI=1S/C15H13ClFN3/c1-8-3-9(2)5-10(4-8)20-14-7-12(17)11(16)6-13(14)19-15(20)18/h3-7H,1-2H3,(H2,18,19) |
| InChIKey | IXFHBPQPADWSRL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |