C13H6ClF4N3 — CID 66078904
5-chloro-6-fluoro-1-(3,4,5-trifluorophenyl)benzimidazol-2-amine (PubChem CID 66078904) has the molecular formula C13H6ClF4N3 and a molecular weight of 315.66 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-(3,4,5-trifluorophenyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-6-fluoro-1-(3,4,5-trifluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66078904 |
| Molecular Formula | C13H6ClF4N3 |
| Molecular Weight | 315.66 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 5-chloro-6-fluoro-1-(3,4,5-trifluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(F)cc2n1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H6ClF4N3/c14-6-3-10-11(4-7(6)15)21(13(19)20-10)5-1-8(16)12(18)9(17)2-5/h1-4H,(H2,19,20) |
| InChIKey | CWQQIHHBFWZLDS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|