C12H12N4O3 — CID 110491555
3-(6-amino-2-oxo-3H-benzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 110491555) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-(6-amino-2-oxo-3H-benzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-amino-2-oxo-3H-benzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 110491555 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-(6-amino-2-oxo-3H-benzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | Nc1ccc2[nH]c(=O)n(C3CCC(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C12H12N4O3/c13-6-1-2-7-9(5-6)16(12(19)14-7)8-3-4-10(17)15-11(8)18/h1-2,5,8H,3-4,13H2,(H,14,19)(H,15,17,18) |
| InChIKey | VTCNOWDWRGZWMX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|