C13H13BN4O2 — CID 166549716
CID 166549716 (PubChem CID 166549716) has the molecular formula C13H13BN4O2 and a molecular weight of 268.08 g/mol.
| Compound Name | CID 166549716 |
|---|---|
| PubChem CID | 166549716 |
| Molecular Formula | C13H13BN4O2 |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc2[nH]c(=O)n(C3CCC(=O)NC3=C)c2cn1 |
| InChI | InChI=1S/C13H13BN4O2/c1-7-10(2-3-12(19)16-7)18-11-6-15-8(5-14)4-9(11)17-13(18)20/h4,6,10H,1-3,5H2,(H,16,19)(H,17,20) |
| InChIKey | ZEBGILGGFXTROX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|