C12H11N3O4 — CID 170777922
3-(6-amino-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (PubChem CID 170777922) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3-(6-amino-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-amino-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170777922 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-(6-amino-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| SMILES | Nc1ccc2c(c1)oc(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H11N3O4/c13-6-1-2-7-9(5-6)19-12(18)15(7)8-3-4-10(16)14-11(8)17/h1-2,5,8H,3-4,13H2,(H,14,16,17) |
| InChIKey | OIDDSTZQOCVGEM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|