C24H31N3O4 — CID 172589997
3-[6-[1-(4-methylcyclohexyl)piperidin-4-yl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 172589997) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[6-[1-(4-methylcyclohexyl)piperidin-4-yl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(4-methylcyclohexyl)piperidin-4-yl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172589997 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-[6-[1-(4-methylcyclohexyl)piperidin-4-yl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | CC1CCC(N2CCC(c3ccc4c(c3)oc(=O)n4C3CCC(=O)NC3=O)CC2)CC1 |
| InChI | InChI=1S/C24H31N3O4/c1-15-2-5-18(6-3-15)26-12-10-16(11-13-26)17-4-7-19-21(14-17)31-24(30)27(19)20-8-9-22(28)25-23(20)29/h4,7,14-16,18,20H,2-3,5-6,8-13H2,1H3,(H,25,28,29) |
| InChIKey | XSSCBFHAFXGUJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|