C19H20N2O6 — CID 177301843
tert-butyl (E)-3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-6-yl]prop-2-enoate (PubChem CID 177301843) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is tert-butyl (E)-3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-6-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 177301843 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | tert-butyl (E)-3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-6-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1ccc2c(c1)oc(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H20N2O6/c1-19(2,3)27-16(23)9-5-11-4-6-12-14(10-11)26-18(25)21(12)13-7-8-15(22)20-17(13)24/h4-6,9-10,13H,7-8H2,1-3H3,(H,20,22,24)/b9-5+ |
| InChIKey | DZTUZEVGTKXXIH-WEVVVXLNSA-N |
| XLogP | 1.93 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|