C17H22N2O4 — CID 163252926
(3S)-3-[6-(2-methylbutan-2-yl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione;molecular hydrogen (PubChem CID 163252926) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3S)-3-[6-(2-methylbutan-2-yl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione;molecular hydrogen.
| Compound Name | (3S)-3-[6-(2-methylbutan-2-yl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 163252926 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3S)-3-[6-(2-methylbutan-2-yl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione;molecular hydrogen |
| SMILES | CCC(C)(C)c1ccc2c(c1)oc(=O)n2[C@H]1CCC(=O)NC1=O.[H][H] |
| InChI | InChI=1S/C17H20N2O4.H2/c1-4-17(2,3)10-5-6-11-13(9-10)23-16(22)19(11)12-7-8-14(20)18-15(12)21;/h5-6,9,12H,4,7-8H2,1-3H3,(H,18,20,21);1H/t12-;/m0./s1 |
| InChIKey | DYNCQLZOLZJPPL-YDALLXLXSA-N |
| XLogP | 2.51 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|