C23H31N5O4 — CID 172591531
3-[2-oxo-6-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 172591531) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[2-oxo-6-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-6-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172591531 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-[2-oxo-6-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3cc(N4CCC(CCN5CCNCC5)CC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C23H31N5O4/c29-21-4-3-19(22(30)25-21)28-18-2-1-17(15-20(18)32-23(28)31)27-11-6-16(7-12-27)5-10-26-13-8-24-9-14-26/h1-2,15-16,19,24H,3-14H2,(H,25,29,30) |
| InChIKey | XDBVSYJFEMHNLE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|