C23H30N4O4 — CID 172592649
3-[2-oxo-6-[1-(piperidin-4-ylmethyl)piperidin-4-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 172592649) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[2-oxo-6-[1-(piperidin-4-ylmethyl)piperidin-4-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-6-[1-(piperidin-4-ylmethyl)piperidin-4-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172592649 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[2-oxo-6-[1-(piperidin-4-ylmethyl)piperidin-4-yl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3cc(C4CCN(CC5CCNCC5)CC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O4/c28-21-4-3-19(22(29)25-21)27-18-2-1-17(13-20(18)31-23(27)30)16-7-11-26(12-8-16)14-15-5-9-24-10-6-15/h1-2,13,15-16,19,24H,3-12,14H2,(H,25,28,29) |
| InChIKey | SZVODEBMMDXXBT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|