C17H22N2O4 — CID 167594496
2-methylbutane;3-(2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (PubChem CID 167594496) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-methylbutane;3-(2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione.
| Compound Name | 2-methylbutane;3-(2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167594496 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-methylbutane;3-(2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| SMILES | CCC(C)C.O=C1CCC(n2c(=O)oc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C12H10N2O4.C5H12/c15-10-6-5-8(11(16)13-10)14-7-3-1-2-4-9(7)18-12(14)17;1-4-5(2)3/h1-4,8H,5-6H2,(H,13,15,16);5H,4H2,1-3H3 |
| InChIKey | IWGZKNWQJFKQMS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|