C21H26N4O5 — CID 176736401
3-[7-[[4-(2-methylpropanoyl)piperazin-1-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 176736401) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[7-[[4-(2-methylpropanoyl)piperazin-1-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-(2-methylpropanoyl)piperazin-1-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176736401 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[7-[[4-(2-methylpropanoyl)piperazin-1-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)C(=O)N1CCN(Cc2cccc3c2oc(=O)n3C2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C21H26N4O5/c1-13(2)20(28)24-10-8-23(9-11-24)12-14-4-3-5-15-18(14)30-21(29)25(15)16-6-7-17(26)22-19(16)27/h3-5,13,16H,6-12H2,1-2H3,(H,22,26,27) |
| InChIKey | YTPCKGKVLFKQSW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|