C16H15N3O5 — CID 168874674
1-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]azetidine-3-carbaldehyde (PubChem CID 168874674) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]azetidine-3-carbaldehyde.
| Compound Name | 1-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]azetidine-3-carbaldehyde |
|---|---|
| PubChem CID | 168874674 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]azetidine-3-carbaldehyde |
| SMILES | O=CC1CN(c2cccc3c2oc(=O)n3C2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C16H15N3O5/c20-8-9-6-18(7-9)10-2-1-3-11-14(10)24-16(23)19(11)12-4-5-13(21)17-15(12)22/h1-3,8-9,12H,4-7H2,(H,17,21,22) |
| InChIKey | UHJDJEXPQFSJLP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|